CAS 1254319-58-8 appears in our catalog under these names: 2-Oxo-2,3-dihydrobenzo[d]oxazol-5-ylboronic acid pinacol ester, 95%, 2-Oxo-2,3-dihydrobenzoxazole-5-boronic acid pinacol ester, 95-<97%, 2-Oxo-2,3-dihydrobenzoxazole-5-boronic acid pinacol ester, ≥97-<99%, 2-Oxo-2,3-dihydrobenzoxazole-5-boronic Acid Pinacol Ester, 2-oxo-2,3-dihydrobenzo[d]oxazol-5-ylboronic acid pinacol ester, 98%, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 2,5g, 10g, 25g, 50g, 2g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1,3-benzoxazol-2-one (CAS 1254319-58-8) is a chemical compound with the molecular formula C13H16BNO4 and a molecular weight of 261.08 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1,3-benzoxazol-2-one. InChIKey: GWJADTWONUXMTN-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO4 |
|---|---|
| Molecular weight | 261.08 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1,3-benzoxazol-2-one |
| InChIKey | GWJADTWONUXMTN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)OC(=O)N3 |
Computed by PubChem (NCBI)