CAS 1072946-60-1 is the registry number for 1-(4-Carboxybutyl)indole-5-boronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
5-(5-boronoindol-1-yl)pentanoic acid (CAS 1072946-60-1) is a chemical compound with the molecular formula C13H16BNO4 and a molecular weight of 261.08 g/mol. IUPAC name: 5-(5-boronoindol-1-yl)pentanoic acid. InChIKey: WAVUJDADJNKCDA-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO4 |
|---|---|
| Molecular weight | 261.08 g/mol |
| IUPAC name | 5-(5-boronoindol-1-yl)pentanoic acid |
| InChIKey | WAVUJDADJNKCDA-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(C=C2)CCCCC(=O)O)(O)O |
Computed by PubChem (NCBI)