Products 1072946-60-1

CAS 1072946-60-1 is the registry number for 1-(4-Carboxybutyl)indole-5-boronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

5-(5-boronoindol-1-yl)pentanoic acid (CAS 1072946-60-1) is a chemical compound with the molecular formula C13H16BNO4 and a molecular weight of 261.08 g/mol. IUPAC name: 5-(5-boronoindol-1-yl)pentanoic acid. InChIKey: WAVUJDADJNKCDA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16BNO4
Molecular weight261.08 g/mol
IUPAC name5-(5-boronoindol-1-yl)pentanoic acid
InChIKeyWAVUJDADJNKCDA-UHFFFAOYSA-N
SMILESB(C1=CC2=C(C=C1)N(C=C2)CCCCC(=O)O)(O)O

Computed by PubChem (NCBI)