Products 1565829-30-2

CAS 1565829-30-2 is the registry number for Phenethylboronic acid mida ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

6-methyl-2-(2-phenylethyl)-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1565829-30-2) is a chemical compound with the molecular formula C13H16BNO4 and a molecular weight of 261.08 g/mol. IUPAC name: 6-methyl-2-(2-phenylethyl)-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: AVFZQTFWXBUICN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16BNO4
Molecular weight261.08 g/mol
IUPAC name6-methyl-2-(2-phenylethyl)-1,3,6,2-dioxazaborocane-4,8-dione
InChIKeyAVFZQTFWXBUICN-UHFFFAOYSA-N
SMILESB1(OC(=O)CN(CC(=O)O1)C)CCC2=CC=CC=C2

Computed by PubChem (NCBI)