1-(tert-Butyl) 4-methyl cubane-1,4-dicarboxylate, 97%
cas: 907557-21-5 — see every product listed under this CAS number, including other names
1-(tert-Butyl) 4-methyl cubane-1,4-dicarboxylate, 97% (CAS 907557-21-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1538753-100mg |
| cas | 907557-21-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 609.56 Pln | |
| Ambeed | 250mg | 1004.50 Pln | |
| Ambeed | 1g | 2751.12 Pln | |
| Ambeed | 5g | 10805.62 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 1125.20 Pln | |
| Chemat | 1g | 3246.80 Pln | |
| Chemat | 5g | 13926.80 Pln | |
| BLDpharm | 100mg | 653.13 Pln | |
| BLDpharm | 250mg | 1080.76 Pln | |
| BLDpharm | 1g | 2963.43 Pln | |
| BLDpharm | 5g | 11649.26 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-O-tert-butyl 1-O-methyl cubane-1,4-dicarboxylate (CAS 907557-21-5) is a chemical compound with the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl cubane-1,4-dicarboxylate. InChIKey: SSXKLFUEFYGJES-UHFFFAOYSA-N.
| Molecular formula | C15H18O4 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl cubane-1,4-dicarboxylate |
| InChIKey | SSXKLFUEFYGJES-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C12C3C4C1C5C2C3C45C(=O)OC |
Computed by PubChem (NCBI)