Products 907557-21-5
CAS 907557-21-5 is the registry number for 1-(tert-Butyl) 4-methyl cubane-1,4-dicarboxylate, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-O-tert-butyl 1-O-methyl cubane-1,4-dicarboxylate (CAS 907557-21-5) is a chemical compound with the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl cubane-1,4-dicarboxylate. InChIKey: SSXKLFUEFYGJES-UHFFFAOYSA-N.
| Molecular formula | C15H18O4 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl cubane-1,4-dicarboxylate |
| InChIKey | SSXKLFUEFYGJES-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C12C3C4C1C5C2C3C45C(=O)OC |
Computed by PubChem (NCBI)