cas: 22184-99-2 — see every product listed under this CAS number, including other names
1-[(3-Aminophenyl)sulfonyl]piperidine, 97%, 97% (CAS 22184-99-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BDK0-1g |
| cas | 22184-99-2 |
| size | 1g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 386.00 Pln | |
| Chemat | 5g | 1077.20 Pln | |
| Chemat | 10g | 1787.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-piperidin-1-ylsulfonylaniline (CAS 22184-99-2) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: 3-piperidin-1-ylsulfonylaniline. InChIKey: AHQOQYXOKZRRPJ-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | 3-piperidin-1-ylsulfonylaniline |
| InChIKey | AHQOQYXOKZRRPJ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)