CAS 125398-82-5 appears in our catalog under these names: 1-(Benzenesulfonyl)-1,4-diazepane, 95%, Isoquinoline Impurity 17, 1-(Phenylsulfonyl)-1,4-diazepane, 97%, 1-(Benzenesulfonyl)-1,4-diazepane. Offered by: Combi-blocks, Chemat Brand, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, on request, 5g, 100mg.
1-(benzenesulfonyl)-1,4-diazepane (CAS 125398-82-5) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: 1-(benzenesulfonyl)-1,4-diazepane. InChIKey: OWUWJUWAQBNHEQ-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-1,4-diazepane |
| InChIKey | OWUWJUWAQBNHEQ-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)