CAS 41840-28-2 appears in our catalog under these names: S-Boc-2-mercapto-4,6-dimethylpyrimidine, 98%, S-Boc-2-mercapto-4,6-dimethylpyrimidine, 97% , S-Boc-2-mercapto-4,6-dimethylpyrimidine 98%, TERT-BUTYL S-(4,6-DIMETHYLPYRIMIDIN-2-Y&, 2-(tert-Butoxycarbonylthio)-4,6-dimethylpyrimidine [Boc Agent for Peptides Synthesis], >98.0%(T). Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich, TCI. Available pack sizes: 25g, 5g, 1g.
Tert-butyl (4,6-dimethylpyrimidin-2-yl)sulfanylformate (CAS 41840-28-2) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: tert-butyl (4,6-dimethylpyrimidin-2-yl)sulfanylformate. InChIKey: POTDIELOEHTPJN-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | tert-butyl (4,6-dimethylpyrimidin-2-yl)sulfanylformate |
| InChIKey | POTDIELOEHTPJN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)