CAS 927996-84-7 is the registry number for 1-(Propylsulfonyl)indolin-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-propylsulfonyl-2,3-dihydroindol-5-amine (CAS 927996-84-7) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: 1-propylsulfonyl-2,3-dihydroindol-5-amine. InChIKey: PWPSHSXVJQDFDU-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | 1-propylsulfonyl-2,3-dihydroindol-5-amine |
| InChIKey | PWPSHSXVJQDFDU-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)N1CCC2=C1C=CC(=C2)N |
Computed by PubChem (NCBI)