CAS 1936303-70-6 appears in our catalog under these names: tert-Butyl (2-cyclopropylthiazol-5-yl)carbamate, 95%, tert–Butyl (2–cyclopropylthiazol–5–yl)carbamate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g, 50mg.
Tert-butyl N-(2-cyclopropyl-1,3-thiazol-5-yl)carbamate (CAS 1936303-70-6) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: tert-butyl N-(2-cyclopropyl-1,3-thiazol-5-yl)carbamate. InChIKey: TXFVNUUHCGQKJG-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | tert-butyl N-(2-cyclopropyl-1,3-thiazol-5-yl)carbamate |
| InChIKey | TXFVNUUHCGQKJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN=C(S1)C2CC2 |
Computed by PubChem (NCBI)