cas: 153207-76-2 — see every product listed under this CAS number, including other names
1-[(3-azidopropane)sulfonyl]-4-methylbenzene, 95% (CAS 153207-76-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F510676-100MG |
| cas | 153207-76-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 544.62 Pln | |
| Fluorochem | 1g | 1330.80 Pln | |
| Fluorochem | 5g | 4793.12 Pln | |
| Fluorochem | 10g | 8125.28 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-azidopropyl 4-methylbenzenesulfonate (CAS 153207-76-2) is a chemical compound with the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. IUPAC name: 3-azidopropyl 4-methylbenzenesulfonate. InChIKey: MMGDPHCMLPGJAE-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3S |
|---|---|
| Molecular weight | 255.30 g/mol |
| IUPAC name | 3-azidopropyl 4-methylbenzenesulfonate |
| InChIKey | MMGDPHCMLPGJAE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)