cas: 153207-76-2 — see every product listed under this CAS number, including other names
3-Azidopropanol tosylate, 95%, 95% (CAS 153207-76-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11J4EI-100mg |
| cas | 153207-76-2 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 1082.00 Pln | |
| Chemat | 5g | 3880.40 Pln | |
| Chemat | 10g | 6491.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-azidopropyl 4-methylbenzenesulfonate (CAS 153207-76-2) is a chemical compound with the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. IUPAC name: 3-azidopropyl 4-methylbenzenesulfonate. InChIKey: MMGDPHCMLPGJAE-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3S |
|---|---|
| Molecular weight | 255.30 g/mol |
| IUPAC name | 3-azidopropyl 4-methylbenzenesulfonate |
| InChIKey | MMGDPHCMLPGJAE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)