CAS 153207-76-2 appears in our catalog under these names: 3-Azidopropyl 4-methylbenzenesulfonate, 95%, 3-Azidopropyl Tosylate, 3–azidopropyl 4–methylbenzenesulfonate, 3-Azidopropyl 4-methylbenzenesulfonate 95%, 3-Azidopropanol tosylate, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg, 10g.
3-azidopropyl 4-methylbenzenesulfonate (CAS 153207-76-2) is a chemical compound with the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. IUPAC name: 3-azidopropyl 4-methylbenzenesulfonate. InChIKey: MMGDPHCMLPGJAE-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3S |
|---|---|
| Molecular weight | 255.30 g/mol |
| IUPAC name | 3-azidopropyl 4-methylbenzenesulfonate |
| InChIKey | MMGDPHCMLPGJAE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)