CAS 1466453-23-5 is the registry number for N-Cyclopropyl-N-(4-ethyl-1,2,3-thiadiazole-5-carbonyl)glycine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[cyclopropyl-(4-ethylthiadiazole-5-carbonyl)amino]acetic acid (CAS 1466453-23-5) is a chemical compound with the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. IUPAC name: 2-[cyclopropyl-(4-ethylthiadiazole-5-carbonyl)amino]acetic acid. InChIKey: QUTNOLBIXGITLY-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3S |
|---|---|
| Molecular weight | 255.30 g/mol |
| IUPAC name | 2-[cyclopropyl-(4-ethylthiadiazole-5-carbonyl)amino]acetic acid |
| InChIKey | QUTNOLBIXGITLY-UHFFFAOYSA-N |
| SMILES | CCC1=C(SN=N1)C(=O)N(CC(=O)O)C2CC2 |
Computed by PubChem (NCBI)