Products 1390654-64-4

CAS 1390654-64-4 is the registry number for [3-(1H-Pyrazol-1-yl)phenyl]amine methanesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

Methanesulfonic acid;3-pyrazol-1-ylaniline (CAS 1390654-64-4) is a chemical compound with the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. IUPAC name: methanesulfonic acid;3-pyrazol-1-ylaniline. InChIKey: ZTVOLIHTIOTOQS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13N3O3S
Molecular weight255.30 g/mol
IUPAC namemethanesulfonic acid;3-pyrazol-1-ylaniline
InChIKeyZTVOLIHTIOTOQS-UHFFFAOYSA-N
SMILESCS(=O)(=O)O.C1=CC(=CC(=C1)N2C=CC=N2)N

Computed by PubChem (NCBI)