CAS 1390654-64-4 is the registry number for [3-(1H-Pyrazol-1-yl)phenyl]amine methanesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
Methanesulfonic acid;3-pyrazol-1-ylaniline (CAS 1390654-64-4) is a chemical compound with the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. IUPAC name: methanesulfonic acid;3-pyrazol-1-ylaniline. InChIKey: ZTVOLIHTIOTOQS-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3S |
|---|---|
| Molecular weight | 255.30 g/mol |
| IUPAC name | methanesulfonic acid;3-pyrazol-1-ylaniline |
| InChIKey | ZTVOLIHTIOTOQS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1=CC(=CC(=C1)N2C=CC=N2)N |
Computed by PubChem (NCBI)