cas: 737790-46-4 — see every product listed under this CAS number, including other names
1-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]cyclopropanemethanol, 98%, 98% (CAS 737790-46-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AFS-100mg |
| cas | 737790-46-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 894.80 Pln | |
| Chemat | 5g | 3424.40 Pln | |
| Chemat | 25g | 9395.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol (CAS 737790-46-4) is a chemical compound with the molecular formula C11H24O2Si and a molecular weight of 216.39 g/mol. IUPAC name: [1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol. InChIKey: RYQZYGDRTDFDEF-UHFFFAOYSA-N.
| Molecular formula | C11H24O2Si |
|---|---|
| Molecular weight | 216.39 g/mol |
| IUPAC name | [1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol |
| InChIKey | RYQZYGDRTDFDEF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1(CC1)CO |
Computed by PubChem (NCBI)