CAS 219539-29-4 is the registry number for 1-[2-(4-Chlorophenyl)-6H-1,3-thiazin-5-yl]ethan-1-one, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 10g, 50g.
1-[2-(4-chlorophenyl)-6H-1,3-thiazin-5-yl]ethanone (CAS 219539-29-4) is a chemical compound with the molecular formula C12H10ClNOS and a molecular weight of 251.73 g/mol. IUPAC name: 1-[2-(4-chlorophenyl)-6H-1,3-thiazin-5-yl]ethanone. InChIKey: NEKOTKLWPGNIOI-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNOS |
|---|---|
| Molecular weight | 251.73 g/mol |
| IUPAC name | 1-[2-(4-chlorophenyl)-6H-1,3-thiazin-5-yl]ethanone |
| InChIKey | NEKOTKLWPGNIOI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C(SC1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)