CAS 349432-62-8 is the registry number for N-(2-chlorophenyl)-2-(2-thienyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2-chlorophenyl)-2-thiophen-2-ylacetamide (CAS 349432-62-8) is a chemical compound with the molecular formula C12H10ClNOS and a molecular weight of 251.73 g/mol. IUPAC name: N-(2-chlorophenyl)-2-thiophen-2-ylacetamide. InChIKey: FOCJNEWTQHQHSB-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNOS |
|---|---|
| Molecular weight | 251.73 g/mol |
| IUPAC name | N-(2-chlorophenyl)-2-thiophen-2-ylacetamide |
| InChIKey | FOCJNEWTQHQHSB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)CC2=CC=CS2)Cl |
Computed by PubChem (NCBI)