Products 547703-15-1
CAS 547703-15-1 is the registry number for 2-Chloro-N-(thiophen-2-ylmethyl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N-(thiophen-2-ylmethyl)benzamide (CAS 547703-15-1) is a chemical compound with the molecular formula C12H10ClNOS and a molecular weight of 251.73 g/mol. IUPAC name: 2-chloro-N-(thiophen-2-ylmethyl)benzamide. InChIKey: DYFRXJSNSWWSPT-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNOS |
|---|---|
| Molecular weight | 251.73 g/mol |
| IUPAC name | 2-chloro-N-(thiophen-2-ylmethyl)benzamide |
| InChIKey | DYFRXJSNSWWSPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCC2=CC=CS2)Cl |
Computed by PubChem (NCBI)