CAS 175137-02-7 is the registry number for 1-[3-Amino-5-(4-chlorophenyl)-2-thienyl]ethan-1-one, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g, 10g.
1-[3-amino-5-(4-chlorophenyl)thiophen-2-yl]ethanone (CAS 175137-02-7) is a chemical compound with the molecular formula C12H10ClNOS and a molecular weight of 251.73 g/mol. IUPAC name: 1-[3-amino-5-(4-chlorophenyl)thiophen-2-yl]ethanone. InChIKey: DLQVOIFYJQATMI-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNOS |
|---|---|
| Molecular weight | 251.73 g/mol |
| IUPAC name | 1-[3-amino-5-(4-chlorophenyl)thiophen-2-yl]ethanone |
| InChIKey | DLQVOIFYJQATMI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(S1)C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)