Products 346663-56-7
CAS 346663-56-7 appears in our catalog under these names: JNK-IN-20, WAY-299819, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
N-(4-chlorophenyl)-2-thiophen-2-ylacetamide (CAS 346663-56-7) is a chemical compound with the molecular formula C12H10ClNOS and a molecular weight of 251.73 g/mol. IUPAC name: N-(4-chlorophenyl)-2-thiophen-2-ylacetamide. InChIKey: CXNUOYHNEAWBGS-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNOS |
|---|---|
| Molecular weight | 251.73 g/mol |
| IUPAC name | N-(4-chlorophenyl)-2-thiophen-2-ylacetamide |
| InChIKey | CXNUOYHNEAWBGS-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CC(=O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)