Products 1443979-28-9
CAS 1443979-28-9 appears in our catalog under these names: 1-(3,4,5-Trifluorophenyl)ethane-1,2-diamine dihydrochloride, 95%, 1-(3,4,5-Trifluorophenyl)ethane-1,2-diamine 2hcl, 95%, 1-(3,4,5-Trifluorophenyl)ethane-1,2-diamine dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
1-(3,4,5-trifluorophenyl)ethane-1,2-diamine;dihydrochloride (CAS 1443979-28-9) is a chemical compound with the molecular formula C8H11Cl2F3N2 and a molecular weight of 263.08 g/mol. IUPAC name: 1-(3,4,5-trifluorophenyl)ethane-1,2-diamine;dihydrochloride. InChIKey: XBGNBVDTEPQWGL-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2F3N2 |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | 1-(3,4,5-trifluorophenyl)ethane-1,2-diamine;dihydrochloride |
| InChIKey | XBGNBVDTEPQWGL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C(CN)N.Cl.Cl |
Computed by PubChem (NCBI)