CAS 2442597-51-3 appears in our catalog under these names: 1-(2-(Trifluoromethyl)pyridin-4-yl)ethanamine dihydrochloride, 95%, 1–(2–(Trifluoromethyl)pyridin–4–yl)ethanamine dihydrochloride, 1-(2-(Trifluoromethyl)pyridin-4-yl)ethanamine dihydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 100mg, 1g, 50mg, 0,5g.
1-[2-(trifluoromethyl)-4-pyridinyl]ethanamine;dihydrochloride (CAS 2442597-51-3) is a chemical compound with the molecular formula C8H11Cl2F3N2 and a molecular weight of 263.08 g/mol. IUPAC name: 1-[2-(trifluoromethyl)-4-pyridinyl]ethanamine;dihydrochloride. InChIKey: QIJNJGNTLRYJAY-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2F3N2 |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | 1-[2-(trifluoromethyl)-4-pyridinyl]ethanamine;dihydrochloride |
| InChIKey | QIJNJGNTLRYJAY-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=NC=C1)C(F)(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)