CAS 2680615-82-9 is the registry number for Methyl({[4-(trifluoromethyl)pyridin-2-yl]methyl})amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
N-methyl-1-[4-(trifluoromethyl)-2-pyridinyl]methanamine;dihydrochloride (CAS 2680615-82-9) is a chemical compound with the molecular formula C8H11Cl2F3N2 and a molecular weight of 263.08 g/mol. IUPAC name: N-methyl-1-[4-(trifluoromethyl)-2-pyridinyl]methanamine;dihydrochloride. InChIKey: FZKDXUIKJLODQY-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2F3N2 |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | N-methyl-1-[4-(trifluoromethyl)-2-pyridinyl]methanamine;dihydrochloride |
| InChIKey | FZKDXUIKJLODQY-UHFFFAOYSA-N |
| SMILES | CNCC1=NC=CC(=C1)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)