cas: 1897342-52-7 — see every product listed under this CAS number, including other names
1-[3-bromo-2-hydroxy-5-(trifluoromethyl)phenyl]ethanone, 97% (CAS 1897342-52-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1333RI-100mg |
| cas | 1897342-52-7 |
| size | 100mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 918.80 Pln | |
| Chemat | 500mg | 1494.80 Pln | |
| Chemat | 1g | 2205.20 Pln | |
| Chemat | 5g | 6496.40 Pln | |
| Chemat | 10g | 10782.80 Pln | |
| Fluorochem | 100mg | 1101.71 Pln | |
| Fluorochem | 250mg | 1695.25 Pln | |
| Fluorochem | 500mg | 2778.21 Pln | |
| Fluorochem | 1g | 4079.83 Pln | |
| Fluorochem | 5g | 11853.14 Pln | |
| Fluorochem | 10g | 19694.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-[3-bromo-2-hydroxy-5-(trifluoromethyl)phenyl]ethanone (CAS 1897342-52-7) is a chemical compound with the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. IUPAC name: 1-[3-bromo-2-hydroxy-5-(trifluoromethyl)phenyl]ethanone. InChIKey: ZKFICJCYSNXPBB-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O2 |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | 1-[3-bromo-2-hydroxy-5-(trifluoromethyl)phenyl]ethanone |
| InChIKey | ZKFICJCYSNXPBB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)C(F)(F)F)Br)O |
Computed by PubChem (NCBI)