Products 518070-15-0
CAS 518070-15-0 appears in our catalog under these names: 2-Bromo-4-(trifluoromethyl)phenylacetic acid, 95%, 2-Bromo-4-(trifluormethyl)phenylacetic acid, 98%, 2-Bromo-4-(trifluormethyl)phenylacetic acid, 97%, 97%, 2-Bromo-4-(trifluormethyl)phenylacetic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g.
2-[2-bromo-4-(trifluoromethyl)phenyl]acetic acid (CAS 518070-15-0) is a chemical compound with the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. IUPAC name: 2-[2-bromo-4-(trifluoromethyl)phenyl]acetic acid. InChIKey: VZOPDTMYQJUIIU-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O2 |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | 2-[2-bromo-4-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | VZOPDTMYQJUIIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)CC(=O)O |
Computed by PubChem (NCBI)