CAS 859213-39-1 appears in our catalog under these names: 4-(Bromomethyl)-3-(trifluoromethyl)benzoic acid, 95%, 4–(Bromomethyl)–3–(trifluoromethyl)benzoic acid, 4-(Bromomethyl)-3-(trifluoromethyl)benzoic acid 96%, 4-(bromomethyl)-3-(trifluoromethyl)benzoic acid, 96%, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-(bromomethyl)-3-(trifluoromethyl)benzoic acid (CAS 859213-39-1) is a chemical compound with the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. IUPAC name: 4-(bromomethyl)-3-(trifluoromethyl)benzoic acid. InChIKey: CMNCOLQPUHQRCN-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O2 |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | 4-(bromomethyl)-3-(trifluoromethyl)benzoic acid |
| InChIKey | CMNCOLQPUHQRCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(F)(F)F)CBr |
Computed by PubChem (NCBI)