CAS 1214362-28-3 is the registry number for Methyl 2-bromo-3-(trifluoromethyl)benzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
Methyl 2-bromo-3-(trifluoromethyl)benzoate (CAS 1214362-28-3) is a chemical compound with the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. IUPAC name: methyl 2-bromo-3-(trifluoromethyl)benzoate. InChIKey: QMJPSZMMZSUXFE-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O2 |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | methyl 2-bromo-3-(trifluoromethyl)benzoate |
| InChIKey | QMJPSZMMZSUXFE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)