CAS 122243-36-1 appears in our catalog under these names: 3'-Bromo-4'-methoxy-2,2,2-trifluoroacetophenone, 95%, 3'-Bromo-4'-methoxy-2,2,2-trifluoroacetophenone, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanone (CAS 122243-36-1) is a chemical compound with the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. IUPAC name: 1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanone. InChIKey: CDYMXKVJKUEJII-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O2 |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | 1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanone |
| InChIKey | CDYMXKVJKUEJII-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)