cas: 2244924-47-6 — see every product listed under this CAS number, including other names
1-[5-Chloro-2-(trifluoromethyl)-4-pyridinyl]ethanone, ≥95%, ≥95% (CAS 2244924-47-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13HT8P-250mg |
| cas | 2244924-47-6 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1000.40 Pln | |
| Chemat | 1g | 2406.80 Pln | |
| Chemat | 5g | 7091.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]ethanone (CAS 2244924-47-6) is a chemical compound with the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. IUPAC name: 1-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]ethanone. InChIKey: VVDNKCXVASDVKZ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO |
|---|---|
| Molecular weight | 223.58 g/mol |
| IUPAC name | 1-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]ethanone |
| InChIKey | VVDNKCXVASDVKZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=NC=C1Cl)C(F)(F)F |
Computed by PubChem (NCBI)