cas: 2225879-17-2 — see every product listed under this CAS number, including other names
1-METHYL-1H-IMIDAZOL-5-AMINE OXALATE, 95%, 95% (CAS 2225879-17-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch135F7F-100mg |
| cas | 2225879-17-2 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 630.80 Pln | |
| Chemat | 250mg | 1106.00 Pln | |
| Chemat | 500mg | 1725.20 Pln | |
| Chemat | 1g | 2704.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-methylimidazol-4-amine;oxalic acid (CAS 2225879-17-2) is a chemical compound with the molecular formula C6H9N3O4 and a molecular weight of 187.15 g/mol. IUPAC name: 3-methylimidazol-4-amine;oxalic acid. InChIKey: WHHAIKIZLNSAHQ-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O4 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 3-methylimidazol-4-amine;oxalic acid |
| InChIKey | WHHAIKIZLNSAHQ-UHFFFAOYSA-N |
| SMILES | CN1C=NC=C1N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)