CAS 1187927-68-9 appears in our catalog under these names: 5-Methyl-1h-imidazol-2-amine oxalate, 95%, 5-Methyl-1H-imidazol-2-amine oxalate, 98%, 5-Methyl-1H-imidazol-2-amine oxalate, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 50mg, 100mg.
5-methyl-1H-imidazol-2-amine;oxalic acid (CAS 1187927-68-9) is a chemical compound with the molecular formula C6H9N3O4 and a molecular weight of 187.15 g/mol. IUPAC name: 5-methyl-1H-imidazol-2-amine;oxalic acid. InChIKey: MTVXRVZNQWFHAH-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O4 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 5-methyl-1H-imidazol-2-amine;oxalic acid |
| InChIKey | MTVXRVZNQWFHAH-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(N1)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)