CAS 352647-66-6 appears in our catalog under these names: 4-(3-Aminopropyl)-1,2,5-oxadiazole-3-carboxylic acid 5-oxide, 95%, 4-(3-aminopropyl)-1,2,5-oxadiazole-3-carboxylic acid 5-oxide. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 100mg, 10mg, 50mg.
4-(3-aminopropyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-carboxylic acid (CAS 352647-66-6) is a chemical compound with the molecular formula C6H9N3O4 and a molecular weight of 187.15 g/mol. IUPAC name: 4-(3-aminopropyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-carboxylic acid. InChIKey: ZCXKKBXIVGYOHV-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O4 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 4-(3-aminopropyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-carboxylic acid |
| InChIKey | ZCXKKBXIVGYOHV-UHFFFAOYSA-N |
| SMILES | C(CC1=[N+](ON=C1C(=O)O)[O-])CN |
Computed by PubChem (NCBI)