CAS 1523618-14-5 appears in our catalog under these names: 1H-Pyrazole-4-methanamine oxalate, 95%, (1H-Pyrazol-4-yl)methanamine oxalate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Oxalic acid;1H-pyrazol-4-ylmethanamine (CAS 1523618-14-5) is a chemical compound with the molecular formula C6H9N3O4 and a molecular weight of 187.15 g/mol. IUPAC name: oxalic acid;1H-pyrazol-4-ylmethanamine. InChIKey: VAYBVCGIZRGHEN-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O4 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | oxalic acid;1H-pyrazol-4-ylmethanamine |
| InChIKey | VAYBVCGIZRGHEN-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN1)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)