CAS 2225879-17-2 appears in our catalog under these names: 1-Methyl-1h-imidazol-5-amine oxalate, 95%, 1-METHYL-1H-IMIDAZOL-5-AMINE OXALATE, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg.
3-methylimidazol-4-amine;oxalic acid (CAS 2225879-17-2) is a chemical compound with the molecular formula C6H9N3O4 and a molecular weight of 187.15 g/mol. IUPAC name: 3-methylimidazol-4-amine;oxalic acid. InChIKey: WHHAIKIZLNSAHQ-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O4 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 3-methylimidazol-4-amine;oxalic acid |
| InChIKey | WHHAIKIZLNSAHQ-UHFFFAOYSA-N |
| SMILES | CN1C=NC=C1N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)