cas: 1100748-78-4 — see every product listed under this CAS number, including other names
1-AMINO-7-BOC-7-AZASPIRO[3.5]NONANE HCL, 97% (CAS 1100748-78-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468255-100MG |
| cas | 1100748-78-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1060.06 Pln | |
| Fluorochem | 250mg | 1403.69 Pln | |
| Fluorochem | 500mg | 2262.76 Pln | |
| Fluorochem | 1g | 3361.33 Pln | |
| Fluorochem | 5g | 9937.14 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-amino-7-azaspiro[3.5]nonane-7-carboxylate;hydrochloride (CAS 1100748-78-4) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 3-amino-7-azaspiro[3.5]nonane-7-carboxylate;hydrochloride. InChIKey: GLRKHHOEBIYDPM-UHFFFAOYSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl 3-amino-7-azaspiro[3.5]nonane-7-carboxylate;hydrochloride |
| InChIKey | GLRKHHOEBIYDPM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC2N)CC1.Cl |
Computed by PubChem (NCBI)