cas: 1100748-78-4 — see every product listed under this CAS number, including other names
tert-butyl 1-amino-7-azaspiro[3.5]nonane-7-carboxylate hydrochloride, 95%, 95% (CAS 1100748-78-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119TWW-100mg |
| cas | 1100748-78-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 779.60 Pln | |
| Chemat | 250mg | 1024.40 Pln | |
| Chemat | 1g | 2238.80 Pln | |
| Chemat | 5g | 4264.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-amino-7-azaspiro[3.5]nonane-7-carboxylate;hydrochloride (CAS 1100748-78-4) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 3-amino-7-azaspiro[3.5]nonane-7-carboxylate;hydrochloride. InChIKey: GLRKHHOEBIYDPM-UHFFFAOYSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl 3-amino-7-azaspiro[3.5]nonane-7-carboxylate;hydrochloride |
| InChIKey | GLRKHHOEBIYDPM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC2N)CC1.Cl |
Computed by PubChem (NCBI)