cas: 107866-54-6 — see every product listed under this CAS number, including other names
1-Acetyl-1H-1,2,3-triazolo[4,5-b]pyridine, >98.0%(T) (CAS 107866-54-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A1219-1G |
| cas | 107866-54-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 836.26 Pln | |
| TCI | 5g | 2994.94 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
1-(triazolo[4,5-b]pyridin-1-yl)ethanone (CAS 107866-54-6) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: 1-(triazolo[4,5-b]pyridin-1-yl)ethanone. InChIKey: SDYATKOQVBKTLQ-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1-(triazolo[4,5-b]pyridin-1-yl)ethanone |
| InChIKey | SDYATKOQVBKTLQ-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=C(N=CC=C2)N=N1 |
Computed by PubChem (NCBI)