cas: 107866-54-6 — see every product listed under this CAS number, including other names
1-Acetyl-1H-1,2,3-triazolo[4,5-b]pyridine, 98% (CAS 107866-54-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F635339-250MG |
| cas | 107866-54-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 706.02 Pln | |
| Fluorochem | 5g | 2294.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(triazolo[4,5-b]pyridin-1-yl)ethanone (CAS 107866-54-6) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: 1-(triazolo[4,5-b]pyridin-1-yl)ethanone. InChIKey: SDYATKOQVBKTLQ-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1-(triazolo[4,5-b]pyridin-1-yl)ethanone |
| InChIKey | SDYATKOQVBKTLQ-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=C(N=CC=C2)N=N1 |
Computed by PubChem (NCBI)