cas: 62368-29-0 — see every product listed under this CAS number, including other names
1-Acetyl-6-amino-2,3-dihydro-1H-indole (CAS 62368-29-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021584-1G |
| cas | 62368-29-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 10g | 206.20 Pln | |
| Fluorochem | 25g | 299.91 Pln |
| delivery time | 2-3 weeks |
|---|
1-(6-amino-2,3-dihydroindol-1-yl)ethanone (CAS 62368-29-0) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 1-(6-amino-2,3-dihydroindol-1-yl)ethanone. InChIKey: LOZKZWIQDVEDCQ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(6-amino-2,3-dihydroindol-1-yl)ethanone |
| InChIKey | LOZKZWIQDVEDCQ-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C=C(C=C2)N |
Computed by PubChem (NCBI)