Products 1956335-58-2
CAS 1956335-58-2 is the registry number for 2,3,6-Trimethyl-1h-pyrrolo[2,3-c]pyridin-7(6h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,3,6-trimethyl-1H-pyrrolo[2,3-c]pyridin-7-one (CAS 1956335-58-2) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 2,3,6-trimethyl-1H-pyrrolo[2,3-c]pyridin-7-one. InChIKey: WRUKUURDBOVHSL-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2,3,6-trimethyl-1H-pyrrolo[2,3-c]pyridin-7-one |
| InChIKey | WRUKUURDBOVHSL-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C=CN(C2=O)C)C |
Computed by PubChem (NCBI)