CAS 62368-29-0 appears in our catalog under these names: 1-Acetyl-6-aminoindoline, 95%, 1-Acetyl-6-aminoindoline, ≥97%, ≥97%, 1-Acetyl-6-amino-2,3-dihydro-1H-indole, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g.
1-(6-amino-2,3-dihydroindol-1-yl)ethanone (CAS 62368-29-0) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 1-(6-amino-2,3-dihydroindol-1-yl)ethanone. InChIKey: LOZKZWIQDVEDCQ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(6-amino-2,3-dihydroindol-1-yl)ethanone |
| InChIKey | LOZKZWIQDVEDCQ-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C=C(C=C2)N |
Computed by PubChem (NCBI)