CAS 915921-59-4 is the registry number for (4,5-Dimethyl-1h-benzimidazol-2-yl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(4,5-dimethyl-1H-benzimidazol-2-yl)methanol (CAS 915921-59-4) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: (4,5-dimethyl-1H-benzimidazol-2-yl)methanol. InChIKey: DXIFJQQSMWQYTC-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (4,5-dimethyl-1H-benzimidazol-2-yl)methanol |
| InChIKey | DXIFJQQSMWQYTC-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NC(=N2)CO)C |
Computed by PubChem (NCBI)