CAS 643087-29-0 is the registry number for 6-Amino-2-methyl-1,2,3,4-tetrahydroisoquinolin-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
6-amino-2-methyl-3,4-dihydroisoquinolin-1-one (CAS 643087-29-0) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 6-amino-2-methyl-3,4-dihydroisoquinolin-1-one. InChIKey: FWPPPTIFLPLVOD-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 6-amino-2-methyl-3,4-dihydroisoquinolin-1-one |
| InChIKey | FWPPPTIFLPLVOD-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1=O)C=CC(=C2)N |
Computed by PubChem (NCBI)