cas: 51501-31-6 — see every product listed under this CAS number, including other names
1-Acetyl-7-amino-2,3-dihydro-1h-indole, 95% (CAS 51501-31-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 1g, 5g, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QI-6759-250mg |
| cas | 51501-31-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1419.31 Pln | |
| Fluorochem | 5g | 4163.14 Pln | |
| Fluorochem | 10g | 7380.75 Pln | |
| Fluorochem | 25g | 16778.48 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-(7-amino-2,3-dihydroindol-1-yl)ethanone (CAS 51501-31-6) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 1-(7-amino-2,3-dihydroindol-1-yl)ethanone. InChIKey: ZFSYJCQFOKJSFE-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(7-amino-2,3-dihydroindol-1-yl)ethanone |
| InChIKey | ZFSYJCQFOKJSFE-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C(=CC=C2)N |
Computed by PubChem (NCBI)