cas: 90001-64-2 — see every product listed under this CAS number, including other names
1-Benzothiophene-2-sulfonyl chloride, 97% (CAS 90001-64-2) is a chemical reagent available from Chemat. Available pack sizes: 250MG. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC12203CB |
| cas | 90001-64-2 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 436.79 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
1-benzothiophene-2-sulfonyl chloride (CAS 90001-64-2) is a chemical compound with the molecular formula C8H5ClO2S2 and a molecular weight of 232.7 g/mol. IUPAC name: 1-benzothiophene-2-sulfonyl chloride. InChIKey: FKIIVBOPAHICHQ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO2S2 |
|---|---|
| Molecular weight | 232.7 g/mol |
| IUPAC name | 1-benzothiophene-2-sulfonyl chloride |
| InChIKey | FKIIVBOPAHICHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)