CAS 70060-23-0 is the registry number for Methyl 6-chlorothieno[3,2-b]thiophene-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-chlorothieno[3,2-b]thiophene-5-carboxylate (CAS 70060-23-0) is a chemical compound with the molecular formula C8H5ClO2S2 and a molecular weight of 232.7 g/mol. IUPAC name: methyl 3-chlorothieno[3,2-b]thiophene-5-carboxylate. InChIKey: ILIQEVWFLWYFLR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO2S2 |
|---|---|
| Molecular weight | 232.7 g/mol |
| IUPAC name | methyl 3-chlorothieno[3,2-b]thiophene-5-carboxylate |
| InChIKey | ILIQEVWFLWYFLR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C(=CS2)Cl |
Computed by PubChem (NCBI)