Products 685129-19-5

CAS 685129-19-5 appears in our catalog under these names: Benzo(b)thiophene-6-sulfonyl chloride, 95%, Benzo[b]thiophene-6-sulfonyl chloride, >95%, >95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.

1-benzothiophene-6-sulfonyl chloride (CAS 685129-19-5) is a chemical compound with the molecular formula C8H5ClO2S2 and a molecular weight of 232.7 g/mol. IUPAC name: 1-benzothiophene-6-sulfonyl chloride. InChIKey: LBFFTKZMMZJDOT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClO2S2
Molecular weight232.7 g/mol
IUPAC name1-benzothiophene-6-sulfonyl chloride
InChIKeyLBFFTKZMMZJDOT-UHFFFAOYSA-N
SMILESC1=CC(=CC2=C1C=CS2)S(=O)(=O)Cl

Computed by PubChem (NCBI)