CAS 90001-64-2 appears in our catalog under these names: 1-Benzothiophene-2-sulfonyl chloride, 95%, 1-Benzothiophene-2-sulfonyl chloride, 97% , Benzo(b)thiophene-2-sulfonyl chloride, 95+%. Offered by: Combi-blocks, Thermo Scientific, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1-benzothiophene-2-sulfonyl chloride (CAS 90001-64-2) is a chemical compound with the molecular formula C8H5ClO2S2 and a molecular weight of 232.7 g/mol. IUPAC name: 1-benzothiophene-2-sulfonyl chloride. InChIKey: FKIIVBOPAHICHQ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO2S2 |
|---|---|
| Molecular weight | 232.7 g/mol |
| IUPAC name | 1-benzothiophene-2-sulfonyl chloride |
| InChIKey | FKIIVBOPAHICHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)