Products 128852-05-1

CAS 128852-05-1 appears in our catalog under these names: 1-Benzothiophene-5-sulfonyl chloride, Benzo(b)thiophene-5-sulfonyl chloride, 95+%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.

1-benzothiophene-5-sulfonyl chloride (CAS 128852-05-1) is a chemical compound with the molecular formula C8H5ClO2S2 and a molecular weight of 232.7 g/mol. IUPAC name: 1-benzothiophene-5-sulfonyl chloride. InChIKey: GBTJHYDVNAYQMM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClO2S2
Molecular weight232.7 g/mol
IUPAC name1-benzothiophene-5-sulfonyl chloride
InChIKeyGBTJHYDVNAYQMM-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CS2)C=C1S(=O)(=O)Cl

Computed by PubChem (NCBI)